CAS 871547-65-8 is the registry number for 2-(4-Phenyl-1,3-thiazol-2-yl)acetohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(4-phenyl-1,3-thiazol-2-yl)acetohydrazide (CAS 871547-65-8) is a chemical compound with the molecular formula C11H11N3OS and a molecular weight of 233.29 g/mol. IUPAC name: 2-(4-phenyl-1,3-thiazol-2-yl)acetohydrazide. InChIKey: HMSHIOWVUCPJNA-UHFFFAOYSA-N.
| Molecular formula | C11H11N3OS |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 2-(4-phenyl-1,3-thiazol-2-yl)acetohydrazide |
| InChIKey | HMSHIOWVUCPJNA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)CC(=O)NN |
Computed by PubChem (NCBI)