CAS 54167-89-4 appears in our catalog under these names: N-(2-Amino-4-phenyl-1,3-thiazol-5-yl)acetamide, 95%, N-(2-Amino-4-phenylthiazol-5-yl)acetamide, 95+%, N-(2-Amino-4-phenyl-1,3-thiazol-5-yl)acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 25g, 1g, 5g.
N-(2-amino-4-phenyl-1,3-thiazol-5-yl)acetamide (CAS 54167-89-4) is a chemical compound with the molecular formula C11H11N3OS and a molecular weight of 233.29 g/mol. IUPAC name: N-(2-amino-4-phenyl-1,3-thiazol-5-yl)acetamide. InChIKey: VRJGYNDGJHUPMA-UHFFFAOYSA-N.
| Molecular formula | C11H11N3OS |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | N-(2-amino-4-phenyl-1,3-thiazol-5-yl)acetamide |
| InChIKey | VRJGYNDGJHUPMA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(N=C(S1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)