Products 61292-08-8
CAS 61292-08-8 appears in our catalog under these names: 4-Methyl-2-phenyl-1,3-thiazole-5-carbohydrazide, 95%, 4-Methyl-2-phenyl-thiazole-5-carboxylic acid hydrazide, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g.
4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide (CAS 61292-08-8) is a chemical compound with the molecular formula C11H11N3OS and a molecular weight of 233.29 g/mol. IUPAC name: 4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide. InChIKey: GQSOVDYCSQOIJB-UHFFFAOYSA-N.
| Molecular formula | C11H11N3OS |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 4-methyl-2-phenyl-1,3-thiazole-5-carbohydrazide |
| InChIKey | GQSOVDYCSQOIJB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=C2)C(=O)NN |
Computed by PubChem (NCBI)