CAS 19575-07-6 appears in our catalog under these names: Methyl 2–quinolinecarboxylate, Methyl quinoline-2-carboxylate/ 99.41% (existing batch purity), Methyl quinoline-2-carboxylate 98%, METHYL 2-QUINOLINECARBOXYLATE, 95%, Methyl quinoline-2-carboxylate, 98%, 98%. Offered by: GLPBio, TargetMol, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 500mg, 250mg, 5g, 10g, 25g, 100g, 500 mg.
Methyl quinoline-2-carboxylate (CAS 19575-07-6) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: methyl quinoline-2-carboxylate. InChIKey: CILJSZLWPHTUIP-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | methyl quinoline-2-carboxylate |
| InChIKey | CILJSZLWPHTUIP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)