CAS 1958026-43-1 is the registry number for 7-Bromo-2-chloropyrido[2,3-b]pyrazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-2-chloro-4H-pyrido[2,3-b]pyrazin-3-one (CAS 1958026-43-1) is a chemical compound with the molecular formula C7H3BrClN3O and a molecular weight of 260.47 g/mol. IUPAC name: 7-bromo-2-chloro-4H-pyrido[2,3-b]pyrazin-3-one. InChIKey: NIXMGSVIBUTBFF-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClN3O |
|---|---|
| Molecular weight | 260.47 g/mol |
| IUPAC name | 7-bromo-2-chloro-4H-pyrido[2,3-b]pyrazin-3-one |
| InChIKey | NIXMGSVIBUTBFF-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=C(C(=O)N2)Cl)Br |
Computed by PubChem (NCBI)