Products 2733473-36-2
CAS 2733473-36-2 is the registry number for 6-Bromo-2-chloropyrido[2,3-d]pyrimidin-4(3H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2-chloro-3H-pyrido[2,3-d]pyrimidin-4-one (CAS 2733473-36-2) is a chemical compound with the molecular formula C7H3BrClN3O and a molecular weight of 260.47 g/mol. IUPAC name: 6-bromo-2-chloro-3H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: LHPKBKKJVICGGE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClN3O |
|---|---|
| Molecular weight | 260.47 g/mol |
| IUPAC name | 6-bromo-2-chloro-3H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | LHPKBKKJVICGGE-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=O)NC(=N2)Cl)Br |
Computed by PubChem (NCBI)