Products 2733093-13-3
CAS 2733093-13-3 is the registry number for 6-Bromo-4-chloropyrido[2,3-d]pyrimidin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4-chloro-3H-pyrido[2,3-d]pyrimidin-2-one (CAS 2733093-13-3) is a chemical compound with the molecular formula C7H3BrClN3O and a molecular weight of 260.47 g/mol. IUPAC name: 6-bromo-4-chloro-3H-pyrido[2,3-d]pyrimidin-2-one. InChIKey: FDBTWYZAUNTYIO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClN3O |
|---|---|
| Molecular weight | 260.47 g/mol |
| IUPAC name | 6-bromo-4-chloro-3H-pyrido[2,3-d]pyrimidin-2-one |
| InChIKey | FDBTWYZAUNTYIO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=NC(=O)NC(=C21)Cl)Br |
Computed by PubChem (NCBI)