CAS 2377496-00-7 is the registry number for 8-Bromo-2-chloropyrido[3,4-b]pyrazin-7-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-2-chloro-6H-pyrido[3,4-b]pyrazin-7-one (CAS 2377496-00-7) is a chemical compound with the molecular formula C7H3BrClN3O and a molecular weight of 260.47 g/mol. IUPAC name: 8-bromo-2-chloro-6H-pyrido[3,4-b]pyrazin-7-one. InChIKey: VDOXLFLTLULSKI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClN3O |
|---|---|
| Molecular weight | 260.47 g/mol |
| IUPAC name | 8-bromo-2-chloro-6H-pyrido[3,4-b]pyrazin-7-one |
| InChIKey | VDOXLFLTLULSKI-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=O)N1)Br)N=C(C=N2)Cl |
Computed by PubChem (NCBI)