CAS 196100-86-4 appears in our catalog under these names: 3-(4,5,6,7-Tetrahydro-2h-indazol-3-yl)propanoic acid, 95%, 3-(4,5,6,7-Tetrahydro-1H-indazol-3-yl)propanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 1g, 5g, 250mg, 100mg.
3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanoic acid (CAS 196100-86-4) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanoic acid. InChIKey: FXWSNXDIXJGVBI-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3-(4,5,6,7-tetrahydro-1H-indazol-3-yl)propanoic acid |
| InChIKey | FXWSNXDIXJGVBI-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2)CCC(=O)O |
Computed by PubChem (NCBI)