Products 1962124-51-1
CAS 1962124-51-1 appears in our catalog under these names: Tasimelteon–d5, Tasimelteon-d5. Offered by: GLPBio, Chemat Brand, TRC, TargetMol, Biosynth. Available pack sizes: 1mg, on request, 25mg, 5mg, 10mg, 50mg, 1 mg.
2,2,3,3,3-pentadeuterio-N-[[(1R,2R)-2-(2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methyl]propanamide (CAS 1962124-51-1) is a chemical compound with the molecular formula C15H19NO2 and a molecular weight of 250.35 g/mol. IUPAC name: 2,2,3,3,3-pentadeuterio-N-[[(1R,2R)-2-(2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methyl]propanamide. InChIKey: PTOIAAWZLUQTIO-WILSWDKCSA-N.
| Molecular formula | C15H19NO2 |
|---|---|
| Molecular weight | 250.35 g/mol |
| IUPAC name | 2,2,3,3,3-pentadeuterio-N-[[(1R,2R)-2-(2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methyl]propanamide |
| InChIKey | PTOIAAWZLUQTIO-WILSWDKCSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(=O)NC[C@@H]1C[C@H]1C2=C3CCOC3=CC=C2 |
Computed by PubChem (NCBI)