CAS 251562-65-9 appears in our catalog under these names: Tasimelteon Impurity 1, N-(((1R,2S)-2-(2,3-Dihydro-4-benzofuranyl)cyclopropyl)methyl)-rel-propanamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
N-[[(1R,2S)-2-(2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methyl]propanamide (CAS 251562-65-9) is a chemical compound with the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. IUPAC name: N-[[(1R,2S)-2-(2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methyl]propanamide. InChIKey: PTOIAAWZLUQTIO-GWCFXTLKSA-N.
| Molecular formula | C15H19NO2 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | N-[[(1R,2S)-2-(2,3-dihydro-1-benzofuran-4-yl)cyclopropyl]methyl]propanamide |
| InChIKey | PTOIAAWZLUQTIO-GWCFXTLKSA-N |
| SMILES | CCC(=O)NC[C@@H]1C[C@@H]1C2=C3CCOC3=CC=C2 |
Computed by PubChem (NCBI)