CAS 19634-60-7 appears in our catalog under these names: Nitrosocytisine, N-Nitrosocytisine, >95% (HPLC), N-Nitrosocytisine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 250mg, 25mg.
(1R,9R)-11-nitroso-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (CAS 19634-60-7) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: (1R,9R)-11-nitroso-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one. InChIKey: VIMLBVWHEGYDNW-DTWKUNHWSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | (1R,9R)-11-nitroso-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| InChIKey | VIMLBVWHEGYDNW-DTWKUNHWSA-N |
| SMILES | C1[C@H]2CN(C[C@@H]1C3=CC=CC(=O)N3C2)N=O |
Computed by PubChem (NCBI)