Products 196391-40-9

CAS 196391-40-9 is the registry number for Methyl 2-(1H-1,3-benzodiazol-2-ylsulfanyl)propanoate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Methyl 2-(1H-benzimidazol-2-ylsulfanyl)propanoate (CAS 196391-40-9) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: methyl 2-(1H-benzimidazol-2-ylsulfanyl)propanoate. InChIKey: CSGQJXYOVIGMRM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O2S
Molecular weight236.29 g/mol
IUPAC namemethyl 2-(1H-benzimidazol-2-ylsulfanyl)propanoate
InChIKeyCSGQJXYOVIGMRM-UHFFFAOYSA-N
SMILESCC(C(=O)OC)SC1=NC2=CC=CC=C2N1

Computed by PubChem (NCBI)