CAS 196500-09-1 is the registry number for 2-Methyl-3-nitrobenzyl Mesylate. Offered by: TRC. Available pack sizes: 250mg.
(2-methyl-3-nitrophenyl)methyl methanesulfonate (CAS 196500-09-1) is a chemical compound with the molecular formula C9H11NO5S and a molecular weight of 245.25 g/mol. IUPAC name: (2-methyl-3-nitrophenyl)methyl methanesulfonate. InChIKey: QPOOUPBAZSYLQM-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5S |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | (2-methyl-3-nitrophenyl)methyl methanesulfonate |
| InChIKey | QPOOUPBAZSYLQM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1[N+](=O)[O-])COS(=O)(=O)C |
Computed by PubChem (NCBI)