CAS 1965305-12-7 is the registry number for α-Cyclopropyl-6-methoxy-α-methyl-2-naphthalenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
1-cyclopropyl-1-(6-methoxynaphthalen-2-yl)ethanol (CAS 1965305-12-7) is a chemical compound with the molecular formula C16H18O2 and a molecular weight of 242.31 g/mol. IUPAC name: 1-cyclopropyl-1-(6-methoxynaphthalen-2-yl)ethanol. InChIKey: MKQLDNRYJFMYQL-UHFFFAOYSA-N.
| Molecular formula | C16H18O2 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | 1-cyclopropyl-1-(6-methoxynaphthalen-2-yl)ethanol |
| InChIKey | MKQLDNRYJFMYQL-UHFFFAOYSA-N |
| SMILES | CC(C1CC1)(C2=CC3=C(C=C2)C=C(C=C3)OC)O |
Computed by PubChem (NCBI)