CAS 1965309-84-5 is the registry number for 5,6,7,8-Tetrahydro-imidazo(1,2-a)pyrazine-2-carboxylic acid dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylic acid;dihydrochloride (CAS 1965309-84-5) is a chemical compound with the molecular formula C7H11Cl2N3O2 and a molecular weight of 240.08 g/mol. IUPAC name: 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylic acid;dihydrochloride. InChIKey: HRAIKBAKKZMNPV-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2N3O2 |
|---|---|
| Molecular weight | 240.08 g/mol |
| IUPAC name | 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylic acid;dihydrochloride |
| InChIKey | HRAIKBAKKZMNPV-UHFFFAOYSA-N |
| SMILES | C1CN2C=C(N=C2CN1)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)