Products 2345666-51-3
CAS 2345666-51-3 appears in our catalog under these names: (3-Nitrobenzyl)hydrazine dihydrochloride, 95%, (3-Nitrobenzyl)hydrazine Dihydrochloride, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat Brand, Chemat. Available pack sizes: 250mg, 1g, on request.
(3-nitrophenyl)methylhydrazine;dihydrochloride (CAS 2345666-51-3) is a chemical compound with the molecular formula C7H11Cl2N3O2 and a molecular weight of 240.08 g/mol. IUPAC name: (3-nitrophenyl)methylhydrazine;dihydrochloride. InChIKey: ZKNGGGANUFLQGV-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2N3O2 |
|---|---|
| Molecular weight | 240.08 g/mol |
| IUPAC name | (3-nitrophenyl)methylhydrazine;dihydrochloride |
| InChIKey | ZKNGGGANUFLQGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CNN.Cl.Cl |
Computed by PubChem (NCBI)