CAS 2155851-95-7 is the registry number for Methyl 2,4,5,6-tetrahydropyrrolo(3,4-c)pyrazole-4-carboxylate dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Methyl 1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxylate;dihydrochloride (CAS 2155851-95-7) is a chemical compound with the molecular formula C7H11Cl2N3O2 and a molecular weight of 240.08 g/mol. IUPAC name: methyl 1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxylate;dihydrochloride. InChIKey: YOMMAJUXHVWQGD-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2N3O2 |
|---|---|
| Molecular weight | 240.08 g/mol |
| IUPAC name | methyl 1,4,5,6-tetrahydropyrrolo[3,4-d]pyrazole-4-carboxylate;dihydrochloride |
| InChIKey | YOMMAJUXHVWQGD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C2=C(CN1)NN=C2.Cl.Cl |
Computed by PubChem (NCBI)