CAS 2344680-60-8 is the registry number for 2-Amino-3-(pyrimidin-5-yl)propanoic acid dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride (CAS 2344680-60-8) is a chemical compound with the molecular formula C7H11Cl2N3O2 and a molecular weight of 240.08 g/mol. IUPAC name: 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride. InChIKey: HIYXKMYRENHAOP-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2N3O2 |
|---|---|
| Molecular weight | 240.08 g/mol |
| IUPAC name | 2-amino-3-pyrimidin-5-ylpropanoic acid;dihydrochloride |
| InChIKey | HIYXKMYRENHAOP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=N1)CC(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)