Products 19678-77-4
CAS 19678-77-4 is the registry number for 6-Bromo-4-methoxy-5-methylthieno[2,3-d]pyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-4-methoxy-5-methylthieno[2,3-d]pyrimidine (CAS 19678-77-4) is a chemical compound with the molecular formula C8H7BrN2OS and a molecular weight of 259.13 g/mol. IUPAC name: 6-bromo-4-methoxy-5-methylthieno[2,3-d]pyrimidine. InChIKey: KVHFWPDSQXIKCD-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2OS |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | 6-bromo-4-methoxy-5-methylthieno[2,3-d]pyrimidine |
| InChIKey | KVHFWPDSQXIKCD-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC=NC(=C12)OC)Br |
Computed by PubChem (NCBI)