CAS 197303-38-1 is the registry number for H-Asp-4MbetaNA. Offered by: Creative Peptides. Available pack sizes: 250mg, 1g.
(3S)-3-amino-4-[(4-methoxynaphthalen-2-yl)amino]-4-oxobutanoic acid (CAS 197303-38-1) is a chemical compound with the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. IUPAC name: (3S)-3-amino-4-[(4-methoxynaphthalen-2-yl)amino]-4-oxobutanoic acid. InChIKey: PKJZGRPKEXFGGS-LBPRGKRZSA-N.
| Molecular formula | C15H16N2O4 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | (3S)-3-amino-4-[(4-methoxynaphthalen-2-yl)amino]-4-oxobutanoic acid |
| InChIKey | PKJZGRPKEXFGGS-LBPRGKRZSA-N |
| SMILES | COC1=CC(=CC2=CC=CC=C21)NC(=O)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)