Products 197316-54-4
CAS 197316-54-4 is the registry number for FR198248. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-methyl-1,3-dihydro-2-benzofuran-1,5,6,7-tetrol (CAS 197316-54-4) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: 4-methyl-1,3-dihydro-2-benzofuran-1,5,6,7-tetrol. InChIKey: GSKYCPXSDLXGEW-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 4-methyl-1,3-dihydro-2-benzofuran-1,5,6,7-tetrol |
| InChIKey | GSKYCPXSDLXGEW-UHFFFAOYSA-N |
| SMILES | CC1=C2COC(C2=C(C(=C1O)O)O)O |
Computed by PubChem (NCBI)