CAS 19733-54-1 appears in our catalog under these names: 3-(4-Nitrophenyl)piperidine hydrochloride, 95%, 3-(4-Nitrophenyl)piperidine hydrochloride, 3-(4-Nitrophenyl)piperidine hydrochloride, 98%, 98%, 3-(4-Nitrophenyl)piperidine hydrochloride, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 0,5g, 100mg, 250mg.
3-(4-nitrophenyl)piperidine;hydrochloride (CAS 19733-54-1) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: 3-(4-nitrophenyl)piperidine;hydrochloride. InChIKey: IDCGZQXKZXYDFL-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 3-(4-nitrophenyl)piperidine;hydrochloride |
| InChIKey | IDCGZQXKZXYDFL-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)