CAS 1974316-58-9 is the registry number for Ethyl 7-chloro-3H-imidazo(4,5-b)pyridine-6-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 0,5g, 5g, 10g.
Ethyl 7-chloro-1H-imidazo[4,5-b]pyridine-6-carboxylate (CAS 1974316-58-9) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 7-chloro-1H-imidazo[4,5-b]pyridine-6-carboxylate. InChIKey: NBZMTKXEXYKPMM-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 7-chloro-1H-imidazo[4,5-b]pyridine-6-carboxylate |
| InChIKey | NBZMTKXEXYKPMM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=C1Cl)NC=N2 |
Computed by PubChem (NCBI)