CAS 197446-34-7 appears in our catalog under these names: 4-(4-Oxopiperidin-1-yl)benzoic acid, 95%, 4-(4-Oxopiperidin-1-yl)benzoic acid, 98%, 4–(4–Oxo–piperidin–1–yl)–benzoic acid, 4-(4-Oxopiperidin-1-yl)benzoic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
4-(4-oxopiperidin-1-yl)benzoic acid (CAS 197446-34-7) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 4-(4-oxopiperidin-1-yl)benzoic acid. InChIKey: NFWVNUAXCFDVFD-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 4-(4-oxopiperidin-1-yl)benzoic acid |
| InChIKey | NFWVNUAXCFDVFD-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)