CAS 197450-39-8 appears in our catalog under these names: 1-(4-Bromo-3-methylphenyl)pyrrolidin-2-one, 95%, 1-(4-Bromo-3-methylphenyl)pyrrolidin-2-one, 98+%, 1-(4-Bromo-3-methylphenyl)pyrrolidin-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 25g, 2,5g.
1-(4-bromo-3-methylphenyl)pyrrolidin-2-one (CAS 197450-39-8) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 1-(4-bromo-3-methylphenyl)pyrrolidin-2-one. InChIKey: UHABBHGGYQEDDZ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 1-(4-bromo-3-methylphenyl)pyrrolidin-2-one |
| InChIKey | UHABBHGGYQEDDZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2CCCC2=O)Br |
Computed by PubChem (NCBI)