Products 1975-81-1
CAS 1975-81-1 appears in our catalog under these names: 5–hydroxy–N–methyl Tryptamine (oxalate), N-Methyl Serotonin Oxalate Salt, >95% (HPLC), Nomega-Methyl-5-hydroxyÂtryptamine oxalate salt, 5-Hydroxy NMT (oxalate). Offered by: GLPBio, TRC, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 100mg, 50mg, 250mg, 1 mg, 500 μg.
3-[2-(methylamino)ethyl]-1H-indol-5-ol;oxalic acid (CAS 1975-81-1) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: 3-[2-(methylamino)ethyl]-1H-indol-5-ol;oxalic acid. InChIKey: DYOZWAJOUTVNAF-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 3-[2-(methylamino)ethyl]-1H-indol-5-ol;oxalic acid |
| InChIKey | DYOZWAJOUTVNAF-UHFFFAOYSA-N |
| SMILES | CNCCC1=CNC2=C1C=C(C=C2)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(2-Methylaminoethyl)indol-5-ol oxalate, N-Omega-methylserotonin oxalate salt, N-omega-Methyl-5-hydroxytryptamine oxalate salt, 5-Hydroxy NMT (oxalate), 3-[2-(methylamino)ethyl]-1H-indol-5-ol;oxalic acid, N-Methyl Serotonin Oxalate Salt, 3-(2-(Methylamino)ethyl)-1H-indol-5-ol oxalate, N-omega-Methylserotonin, N-METHYLSEROTONIN HYDROGENOXALATE, 3-[2-(methylamino)ethyl]-1H-indol-5-ol; oxalic acid