Products 1976202-20-6
CAS 1976202-20-6 is the registry number for 3'-Bromo-2',6'-difluoro-[1,1'-biphenyl]-3-carbaldehyde, ≥99%. Offered by: Chemat. Available pack sizes: 1g.
3-(3-bromo-2,6-difluorophenyl)benzaldehyde (CAS 1976202-20-6) is a chemical compound with the molecular formula C13H7BrF2O and a molecular weight of 297.09 g/mol. IUPAC name: 3-(3-bromo-2,6-difluorophenyl)benzaldehyde. InChIKey: AFCGHQBUSDQEHV-UHFFFAOYSA-N.
| Molecular formula | C13H7BrF2O |
|---|---|
| Molecular weight | 297.09 g/mol |
| IUPAC name | 3-(3-bromo-2,6-difluorophenyl)benzaldehyde |
| InChIKey | AFCGHQBUSDQEHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=C(C=CC(=C2F)Br)F)C=O |
Computed by PubChem (NCBI)