CAS 19776-83-1 is the registry number for (S)-1,4(1,4)-Dibenzenacyclohexaphane-12-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carboxylic acid (CAS 19776-83-1) is a chemical compound with the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. IUPAC name: tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carboxylic acid. InChIKey: SWTPMSKJIWTBTQ-UHFFFAOYSA-N.
| Molecular formula | C17H16O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene-5-carboxylic acid |
| InChIKey | SWTPMSKJIWTBTQ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(CCC3=CC=C1C=C3)C=C2)C(=O)O |
Computed by PubChem (NCBI)