CAS 87751-69-7 appears in our catalog under these names: (+/-)-Trans-1,3-diphenylallyl acetate, 95%, (+-)-TRANS-1,3-DIPHENYLALLYL ACETATE, (E)-1,3-diphenylallyl acetate, 95%, 95%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 100mg, 250mg.
[(E)-1,3-diphenylprop-2-enyl] acetate (CAS 87751-69-7) is a chemical compound with the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. IUPAC name: [(E)-1,3-diphenylprop-2-enyl] acetate. InChIKey: UVJZGFKZGQSKDV-OUKQBFOZSA-N.
| Molecular formula | C17H16O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | [(E)-1,3-diphenylprop-2-enyl] acetate |
| InChIKey | UVJZGFKZGQSKDV-OUKQBFOZSA-N |
| SMILES | CC(=O)OC(/C=C/C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)