CAS 109463-48-1 appears in our catalog under these names: Ethyl stilbene-4-carboxylate, 95%, Ethyl Stilbene–4–carboxylate, (E)-Ethyl Stilbene-4-carboxylate, >98.0%(GC), (E)-Ethyl 4-styrylbenzoate 95%, (E)-Ethyl 4-styrylbenzoate, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg.
Ethyl 4-[(E)-2-phenylethenyl]benzoate (CAS 109463-48-1) is a chemical compound with the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. IUPAC name: ethyl 4-[(E)-2-phenylethenyl]benzoate. InChIKey: RBQGAPDZGPQIDL-CMDGGOBGSA-N.
| Molecular formula | C17H16O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | ethyl 4-[(E)-2-phenylethenyl]benzoate |
| InChIKey | RBQGAPDZGPQIDL-CMDGGOBGSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)