CAS 62375-98-8 is the registry number for 3-Hydroxy-1,3-di-p-tolylprop-2-en-1-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-3-hydroxy-1,3-bis(4-methylphenyl)prop-2-en-1-one (CAS 62375-98-8) is a chemical compound with the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. IUPAC name: (Z)-3-hydroxy-1,3-bis(4-methylphenyl)prop-2-en-1-one. InChIKey: BEAQJCSIBXPJBM-WJDWOHSUSA-N.
| Molecular formula | C17H16O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | (Z)-3-hydroxy-1,3-bis(4-methylphenyl)prop-2-en-1-one |
| InChIKey | BEAQJCSIBXPJBM-WJDWOHSUSA-N |
| SMILES | CC1=CC=C(C=C1)/C(=C/C(=O)C2=CC=C(C=C2)C)/O |
Computed by PubChem (NCBI)