Products 1979947-69-7
CAS 1979947-69-7 is the registry number for 1-(2-Dibenzofuranyl)-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-dibenzofuran-2-yl-2,2-difluoroethanone (CAS 1979947-69-7) is a chemical compound with the molecular formula C14H8F2O2 and a molecular weight of 246.21 g/mol. IUPAC name: 1-dibenzofuran-2-yl-2,2-difluoroethanone. InChIKey: PVDDMBOZACAGHF-UHFFFAOYSA-N.
| Molecular formula | C14H8F2O2 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 1-dibenzofuran-2-yl-2,2-difluoroethanone |
| InChIKey | PVDDMBOZACAGHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)C(=O)C(F)F |
Computed by PubChem (NCBI)