CAS 573-43-3 appears in our catalog under these names: 1,2–Bis(2–fluorophenyl)ethane–1,2–dione, 1,2-Bis(2-fluorophenyl)ethane-1,2-dione, 98%, 98%, Ethanedione, bis(2-fluorophenyl)-, 98%(GC-MS),RG. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g.
1,2-bis(2-fluorophenyl)ethane-1,2-dione (CAS 573-43-3) is a chemical compound with the molecular formula C14H8F2O2 and a molecular weight of 246.21 g/mol. IUPAC name: 1,2-bis(2-fluorophenyl)ethane-1,2-dione. InChIKey: UWQCHLREAXYCBW-UHFFFAOYSA-N.
| Molecular formula | C14H8F2O2 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 1,2-bis(2-fluorophenyl)ethane-1,2-dione |
| InChIKey | UWQCHLREAXYCBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(=O)C2=CC=CC=C2F)F |
Computed by PubChem (NCBI)