CAS 70028-89-6 appears in our catalog under these names: 1,2–bis(3–fluorophenyl)ethane–1,2–dione, 1,2-bis(3-fluorophenyl)ethane-1,2-dione, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 10g, 50g, 1g, 5g, 25g.
1,2-bis(3-fluorophenyl)ethane-1,2-dione (CAS 70028-89-6) is a chemical compound with the molecular formula C14H8F2O2 and a molecular weight of 246.21 g/mol. IUPAC name: 1,2-bis(3-fluorophenyl)ethane-1,2-dione. InChIKey: NIOZEPOIIGVTTO-UHFFFAOYSA-N.
| Molecular formula | C14H8F2O2 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 1,2-bis(3-fluorophenyl)ethane-1,2-dione |
| InChIKey | NIOZEPOIIGVTTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)C(=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)