CAS 579-39-5 appears in our catalog under these names: 4,4'-Difluorobenzil, 97%, 4,4'–Difluorobenzil, 4,4'-Difluorobenzil, >98.0%(GC), 4,4'-Difluorobenzil 98%, 1,2-Bis(4-fluorophenyl)ethane-1,2-dione, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 100g, 10g.
1,2-bis(4-fluorophenyl)ethane-1,2-dione (CAS 579-39-5) is a chemical compound with the molecular formula C14H8F2O2 and a molecular weight of 246.21 g/mol. IUPAC name: 1,2-bis(4-fluorophenyl)ethane-1,2-dione. InChIKey: BRKULQOUSCHDGS-UHFFFAOYSA-N.
| Molecular formula | C14H8F2O2 |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 1,2-bis(4-fluorophenyl)ethane-1,2-dione |
| InChIKey | BRKULQOUSCHDGS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)C2=CC=C(C=C2)F)F |
Computed by PubChem (NCBI)