CAS 1982761-03-4 is the registry number for 4-Methoxy-3-(1h-1,2,4-triazol-1-ylmethyl)benzaldehyde dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-methoxy-3-(1,2,4-triazol-1-ylmethyl)benzaldehyde;dihydrochloride (CAS 1982761-03-4) is a chemical compound with the molecular formula C11H13Cl2N3O2 and a molecular weight of 290.14 g/mol. IUPAC name: 4-methoxy-3-(1,2,4-triazol-1-ylmethyl)benzaldehyde;dihydrochloride. InChIKey: WONBRFSMFXRESC-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N3O2 |
|---|---|
| Molecular weight | 290.14 g/mol |
| IUPAC name | 4-methoxy-3-(1,2,4-triazol-1-ylmethyl)benzaldehyde;dihydrochloride |
| InChIKey | WONBRFSMFXRESC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C=O)CN2C=NC=N2.Cl.Cl |
Computed by PubChem (NCBI)