Products 345617-16-5
CAS 345617-16-5 is the registry number for N2,N6-Bis(2-chloroethyl)pyridine-2,6-dicarboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-N,6-N-bis(2-chloroethyl)pyridine-2,6-dicarboxamide (CAS 345617-16-5) is a chemical compound with the molecular formula C11H13Cl2N3O2 and a molecular weight of 290.14 g/mol. IUPAC name: 2-N,6-N-bis(2-chloroethyl)pyridine-2,6-dicarboxamide. InChIKey: QJZAOCYEAADFMR-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N3O2 |
|---|---|
| Molecular weight | 290.14 g/mol |
| IUPAC name | 2-N,6-N-bis(2-chloroethyl)pyridine-2,6-dicarboxamide |
| InChIKey | QJZAOCYEAADFMR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)NCCCl)C(=O)NCCCl |
Computed by PubChem (NCBI)