CAS 338404-01-6 is the registry number for 1-[(3,4-Dichlorophenyl)methoxy]-3-[(1e)-(dimethylamino)methylidene]urea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(3E)-1-[(3,4-dichlorophenyl)methoxy]-3-(dimethylaminomethylidene)urea (CAS 338404-01-6) is a chemical compound with the molecular formula C11H13Cl2N3O2 and a molecular weight of 290.14 g/mol. IUPAC name: (3E)-1-[(3,4-dichlorophenyl)methoxy]-3-(dimethylaminomethylidene)urea. InChIKey: UCZOOPPLUIDQPY-VGOFMYFVSA-N.
| Molecular formula | C11H13Cl2N3O2 |
|---|---|
| Molecular weight | 290.14 g/mol |
| IUPAC name | (3E)-1-[(3,4-dichlorophenyl)methoxy]-3-(dimethylaminomethylidene)urea |
| InChIKey | UCZOOPPLUIDQPY-VGOFMYFVSA-N |
| SMILES | CN(C)/C=N/C(=O)NOCC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)