CAS 897287-52-4 is the registry number for N-Cyclopentyl-2-(4,5-dichloro-6-oxopyridazin-1(6H)-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-cyclopentyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide (CAS 897287-52-4) is a chemical compound with the molecular formula C11H13Cl2N3O2 and a molecular weight of 290.14 g/mol. IUPAC name: N-cyclopentyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide. InChIKey: LGJKVXCSHWOXMO-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N3O2 |
|---|---|
| Molecular weight | 290.14 g/mol |
| IUPAC name | N-cyclopentyl-2-(4,5-dichloro-6-oxopyridazin-1-yl)acetamide |
| InChIKey | LGJKVXCSHWOXMO-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=O)CN2C(=O)C(=C(C=N2)Cl)Cl |
Computed by PubChem (NCBI)