CAS 19853-69-1 appears in our catalog under these names: 5,7-Dichloro-6-methylquinoxaline, 95+%, 5,7-Dichloro-6-methylquinoxaline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5,7-dichloro-6-methylquinoxaline (CAS 19853-69-1) is a chemical compound with the molecular formula C9H6Cl2N2 and a molecular weight of 213.06 g/mol. IUPAC name: 5,7-dichloro-6-methylquinoxaline. InChIKey: DBCCJZIKAPRPNZ-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 5,7-dichloro-6-methylquinoxaline |
| InChIKey | DBCCJZIKAPRPNZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC=CN=C2C=C1Cl)Cl |
Computed by PubChem (NCBI)