CAS 19860-27-6 appears in our catalog under these names: 5-Phenylpyrrolidine-2,4-dione, 95%, 5-Phenylpyrrolidine-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-phenylpyrrolidine-2,4-dione (CAS 19860-27-6) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 5-phenylpyrrolidine-2,4-dione. InChIKey: LSZJFPBAFFVDNJ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 5-phenylpyrrolidine-2,4-dione |
| InChIKey | LSZJFPBAFFVDNJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)C(NC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)