CAS 1987879-58-2 appears in our catalog under these names: 5-Chloro-2-(cyclopropylmethoxy)pyridine-3-boronic acid, 96%, 5-Chloro-2-(cyclopropylmethoxy)pyridine-3-boronic acid, 96%, 96%, (5-Chloro-2-(cyclopropylmethoxy)pyridin-3-yl)boronic acid, 96%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
[5-chloro-2-(cyclopropylmethoxy)-3-pyridinyl]boronic acid (CAS 1987879-58-2) is a chemical compound with the molecular formula C9H11BClNO3 and a molecular weight of 227.45 g/mol. IUPAC name: [5-chloro-2-(cyclopropylmethoxy)-3-pyridinyl]boronic acid. InChIKey: CNZIIFPLGKAYOP-UHFFFAOYSA-N.
| Molecular formula | C9H11BClNO3 |
|---|---|
| Molecular weight | 227.45 g/mol |
| IUPAC name | [5-chloro-2-(cyclopropylmethoxy)-3-pyridinyl]boronic acid |
| InChIKey | CNZIIFPLGKAYOP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1OCC2CC2)Cl)(O)O |
Computed by PubChem (NCBI)