CAS 850589-47-8 appears in our catalog under these names: 3-Chloro-4-(N,N-dimethylcarbamoyl)phenylboronic acid, 98%, 3–Chloro–4–(dimethylcarbamoyl)benzeneboronic acid, 3-Chloro-4-(N,N-dimethylcarbamoyl)phenylboronic acid, 97%, 97%, (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid, 97%, (3-Chloro-4-(dimethylcarbamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 50mg, 100mg.
[3-chloro-4-(dimethylcarbamoyl)phenyl]boronic acid (CAS 850589-47-8) is a chemical compound with the molecular formula C9H11BClNO3 and a molecular weight of 227.45 g/mol. IUPAC name: [3-chloro-4-(dimethylcarbamoyl)phenyl]boronic acid. InChIKey: FRYXYHGYFIBOQR-UHFFFAOYSA-N.
| Molecular formula | C9H11BClNO3 |
|---|---|
| Molecular weight | 227.45 g/mol |
| IUPAC name | [3-chloro-4-(dimethylcarbamoyl)phenyl]boronic acid |
| InChIKey | FRYXYHGYFIBOQR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)N(C)C)Cl)(O)O |
Computed by PubChem (NCBI)