CAS 957120-57-9 appears in our catalog under these names: N-Dimethyl 3-borono-5-chlorobenzamide, 98%, 98%, (3-Chloro-5-(dimethylcarbamoyl)phenyl)boronic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g.
[3-chloro-5-(dimethylcarbamoyl)phenyl]boronic acid (CAS 957120-57-9) is a chemical compound with the molecular formula C9H11BClNO3 and a molecular weight of 227.45 g/mol. IUPAC name: [3-chloro-5-(dimethylcarbamoyl)phenyl]boronic acid. InChIKey: CBWMBTZDVFPIKS-UHFFFAOYSA-N.
| Molecular formula | C9H11BClNO3 |
|---|---|
| Molecular weight | 227.45 g/mol |
| IUPAC name | [3-chloro-5-(dimethylcarbamoyl)phenyl]boronic acid |
| InChIKey | CBWMBTZDVFPIKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Cl)C(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)