CAS 874460-05-6 is the registry number for N-(2-Chloroethyl) 4-boronobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[4-(2-chloroethylcarbamoyl)phenyl]boronic acid (CAS 874460-05-6) is a chemical compound with the molecular formula C9H11BClNO3 and a molecular weight of 227.45 g/mol. IUPAC name: [4-(2-chloroethylcarbamoyl)phenyl]boronic acid. InChIKey: VQLHHAJGSFUYCS-UHFFFAOYSA-N.
| Molecular formula | C9H11BClNO3 |
|---|---|
| Molecular weight | 227.45 g/mol |
| IUPAC name | [4-(2-chloroethylcarbamoyl)phenyl]boronic acid |
| InChIKey | VQLHHAJGSFUYCS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCCCl)(O)O |
Computed by PubChem (NCBI)