Products 1989659-62-2

CAS 1989659-62-2 is the registry number for 2-((2,2-Dimethylpropyl)(methyl)amino)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[2,2-dimethylpropyl(methyl)amino]acetic acid;hydrochloride (CAS 1989659-62-2) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: 2-[2,2-dimethylpropyl(methyl)amino]acetic acid;hydrochloride. InChIKey: CHSBFHUUAZRITC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18ClNO2
Molecular weight195.69 g/mol
IUPAC name2-[2,2-dimethylpropyl(methyl)amino]acetic acid;hydrochloride
InChIKeyCHSBFHUUAZRITC-UHFFFAOYSA-N
SMILESCC(C)(C)CN(C)CC(=O)O.Cl

Computed by PubChem (NCBI)