CAS 1990505-73-1 appears in our catalog under these names: Ticagrelor Impurity 110 HCl, (1S,2R)–2–(4–Fluoro–phenyl)–cyclopropylamine hydrochloride, (1S,2R)-2-(4-Fluoro-phenyl)-cyclopropylamine hydrochloride 95%, (1S,2R)-2-(4-Fluorophenyl)cyclopropanamine Hydrochloride, 95%, 95%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 100mg, 50mg, 250mg, 1g.
Trans-(1S,2R)-2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1990505-73-1) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: trans-(1S,2R)-2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: ZQPBZLHQLCAFOQ-RJUBDTSPSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | trans-(1S,2R)-2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | ZQPBZLHQLCAFOQ-RJUBDTSPSA-N |
| SMILES | C1[C@@H]([C@H]1N)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)