CAS 199105-26-5 is the registry number for 3,4-Dihydrospiro(1-benzopyran-2,3'-piperidine)-4-one hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Spiro[3H-chromene-2,3'-piperidine]-4-one;hydrochloride (CAS 199105-26-5) is a chemical compound with the molecular formula C13H16ClNO2 and a molecular weight of 253.72 g/mol. IUPAC name: spiro[3H-chromene-2,3'-piperidine]-4-one;hydrochloride. InChIKey: MDJMGJJYDDMATF-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO2 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | spiro[3H-chromene-2,3'-piperidine]-4-one;hydrochloride |
| InChIKey | MDJMGJJYDDMATF-UHFFFAOYSA-N |
| SMILES | C1CC2(CC(=O)C3=CC=CC=C3O2)CNC1.Cl |
Computed by PubChem (NCBI)