CAS 199277-87-7 appears in our catalog under these names: 6,7-Dihydro-5h-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-amine, 95%, 6,7-Dihydro-5H-cyclopenta(4,5)thieno(2,3-d)pyrimidin-4-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 10g.
7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (CAS 199277-87-7) is a chemical compound with the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. IUPAC name: 7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine. InChIKey: VHROFEHOOFIVDR-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S |
|---|---|
| Molecular weight | 191.26 g/mol |
| IUPAC name | 7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| InChIKey | VHROFEHOOFIVDR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC3=NC=NC(=C23)N |
Computed by PubChem (NCBI)